C23H30O6 — CID 72612184
3-[12-[(2,5-dioxooxolan-3-yl)methyl]tetradeca-2,7,13-trienyl]oxolane-2,5-dione (PubChem CID 72612184) has the molecular formula C23H30O6 and a molecular weight of 402.49 g/mol. Its IUPAC name is 3-[12-[(2,5-dioxooxolan-3-yl)methyl]tetradeca-2,7,13-trienyl]oxolane-2,5-dione.
| Compound Name | 3-[12-[(2,5-dioxooxolan-3-yl)methyl]tetradeca-2,7,13-trienyl]oxolane-2,5-dione |
|---|---|
| PubChem CID | 72612184 |
| Molecular Formula | C23H30O6 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | 3-[12-[(2,5-dioxooxolan-3-yl)methyl]tetradeca-2,7,13-trienyl]oxolane-2,5-dione |
| SMILES | C=CC(CCCC=CCCCC=CCC1CC(=O)OC1=O)CC1CC(=O)OC1=O |
| InChI | InChI=1S/C23H30O6/c1-2-17(14-19-16-21(25)29-23(19)27)12-10-8-6-4-3-5-7-9-11-13-18-15-20(24)28-22(18)26/h2,4,6,9,11,17-19H,1,3,5,7-8,10,12-16H2 |
| InChIKey | MTBGBFVZSNOJHI-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|