C14H24N3O+ — CID 7261327
[2-[cyclopropyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-propylazanium (PubChem CID 7261327) has the molecular formula C14H24N3O+ and a molecular weight of 250.37 g/mol. Its IUPAC name is [2-[cyclopropyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-propylazanium.
| Compound Name | [2-[cyclopropyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-propylazanium |
|---|---|
| PubChem CID | 7261327 |
| Molecular Formula | C14H24N3O+ |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | [2-[cyclopropyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-propylazanium |
| SMILES | CCC[NH2+]CC(=O)N(Cc1cccn1C)C1CC1 |
| InChI | InChI=1S/C14H23N3O/c1-3-8-15-10-14(18)17(12-6-7-12)11-13-5-4-9-16(13)2/h4-5,9,12,15H,3,6-8,10-11H2,1-2H3/p+1 |
| InChIKey | RPQWKLNKFWMLPV-UHFFFAOYSA-O |
| XLogP | 0.49 |
| TPSA | 41.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|