C26H36N2O3 — CID 72614977
(11-formyl-4-methyl-1-propan-2-yl-1,2,4a,5,6,7,10,11,12,12a-decahydrobenzo[10]annulen-6-yl) 3-(1-methylimidazol-4-yl)prop-2-enoate (PubChem CID 72614977) has the molecular formula C26H36N2O3 and a molecular weight of 424.59 g/mol. Its IUPAC name is (11-formyl-4-methyl-1-propan-2-yl-1,2,4a,5,6,7,10,11,12,12a-decahydrobenzo[10]annulen-6-yl) 3-(1-methylimidazol-4-yl)prop-2-enoate.
| Compound Name | (11-formyl-4-methyl-1-propan-2-yl-1,2,4a,5,6,7,10,11,12,12a-decahydrobenzo[10]annulen-6-yl) 3-(1-methylimidazol-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 72614977 |
| Molecular Formula | C26H36N2O3 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.27 |
| IUPAC Name | (11-formyl-4-methyl-1-propan-2-yl-1,2,4a,5,6,7,10,11,12,12a-decahydrobenzo[10]annulen-6-yl) 3-(1-methylimidazol-4-yl)prop-2-enoate |
| SMILES | CC1=CCC(C(C)C)C2CC(C=O)CC=CCC(OC(=O)C=Cc3cn(C)cn3)CC12 |
| InChI | InChI=1S/C26H36N2O3/c1-18(2)23-11-9-19(3)24-14-22(8-6-5-7-20(16-29)13-25(23)24)31-26(30)12-10-21-15-28(4)17-27-21/h5-6,9-10,12,15-18,20,22-25H,7-8,11,13-14H2,1-4H3 |
| InChIKey | IQKUPGOLFWDYLS-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|