C19H25F2N3O3 — CID 72615126
N-[5-amino-6-(3,3-difluoropyrrolidin-1-yl)-6-oxohexyl]-2,3-dihydro-1-benzofuran-2-carboxamide (PubChem CID 72615126) has the molecular formula C19H25F2N3O3 and a molecular weight of 381.42 g/mol. Its IUPAC name is N-[5-amino-6-(3,3-difluoropyrrolidin-1-yl)-6-oxohexyl]-2,3-dihydro-1-benzofuran-2-carboxamide.
| Compound Name | N-[5-amino-6-(3,3-difluoropyrrolidin-1-yl)-6-oxohexyl]-2,3-dihydro-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 72615126 |
| Molecular Formula | C19H25F2N3O3 |
| Molecular Weight | 381.42 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | N-[5-amino-6-(3,3-difluoropyrrolidin-1-yl)-6-oxohexyl]-2,3-dihydro-1-benzofuran-2-carboxamide |
| SMILES | NC(CCCCNC(=O)C1Cc2ccccc2O1)C(=O)N1CCC(F)(F)C1 |
| InChI | InChI=1S/C19H25F2N3O3/c20-19(21)8-10-24(12-19)18(26)14(22)6-3-4-9-23-17(25)16-11-13-5-1-2-7-15(13)27-16/h1-2,5,7,14,16H,3-4,6,8-12,22H2,(H,23,25) |
| InChIKey | PATRPPWEHCPCKQ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.42 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|