C13H19NO — CID 726177
1-[(2S,6S)-2,6-bis(prop-2-enyl)-3,6-dihydro-2H-pyridin-1-yl]ethanone (PubChem CID 726177) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is 1-[(2S,6S)-2,6-bis(prop-2-enyl)-3,6-dihydro-2H-pyridin-1-yl]ethanone.
| Compound Name | 1-[(2S,6S)-2,6-bis(prop-2-enyl)-3,6-dihydro-2H-pyridin-1-yl]ethanone |
|---|---|
| PubChem CID | 726177 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 1-[(2S,6S)-2,6-bis(prop-2-enyl)-3,6-dihydro-2H-pyridin-1-yl]ethanone |
| SMILES | C=CC[C@H]1CC=C[C@H](CC=C)N1C(C)=O |
| InChI | InChI=1S/C13H19NO/c1-4-7-12-9-6-10-13(8-5-2)14(12)11(3)15/h4-6,9,12-13H,1-2,7-8,10H2,3H3/t12-,13-/m0/s1 |
| InChIKey | VGMRLIHUGUAMLX-STQMWFEESA-N |
| XLogP | 2.68 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|