C46H48N3S+ — CID 72618871
4-[2-[2-(1,1,3-trimethyl-3a,4-dihydrobenzo[e]indol-3-ium-2-yl)ethenyl]-6-[2-(1,1,3-trimethylbenzo[e]indol-2-ylidene)ethylidene]cyclohexen-1-yl]sulfanylaniline (PubChem CID 72618871) has the molecular formula C46H48N3S+ and a molecular weight of 674.98 g/mol. Its IUPAC name is 4-[2-[2-(1,1,3-trimethyl-3a,4-dihydrobenzo[e]indol-3-ium-2-yl)ethenyl]-6-[2-(1,1,3-trimethylbenzo[e]indol-2-ylidene)ethylidene]cyclohexen-1-yl]sulfanylaniline.
| Compound Name | 4-[2-[2-(1,1,3-trimethyl-3a,4-dihydrobenzo[e]indol-3-ium-2-yl)ethenyl]-6-[2-(1,1,3-trimethylbenzo[e]indol-2-ylidene)ethylidene]cyclohexen-1-yl]sulfanylaniline |
|---|---|
| PubChem CID | 72618871 |
| Molecular Formula | C46H48N3S+ |
| Molecular Weight | 674.98 g/mol |
| Exact Mass | 674.36 |
| IUPAC Name | 4-[2-[2-(1,1,3-trimethyl-3a,4-dihydrobenzo[e]indol-3-ium-2-yl)ethenyl]-6-[2-(1,1,3-trimethylbenzo[e]indol-2-ylidene)ethylidene]cyclohexen-1-yl]sulfanylaniline |
| SMILES | CN1C(=CC=C2CCCC(C=CC3=[N+](C)C4CC=c5ccccc5=C4C3(C)C)=C2Sc2ccc(N)cc2)C(C)(C)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C46H48N3S/c1-45(2)40(48(5)38-26-18-30-12-7-9-16-36(30)42(38)45)28-20-32-14-11-15-33(44(32)50-35-24-22-34(47)23-25-35)21-29-41-46(3,4)43-37-17-10-8-13-31(37)19-27-39(43)49(41)6/h7-10,12-13,16-26,28-29,39H,11,14-15,27,47H2,1-6H3/q+1 |
| InChIKey | BQLOPSNVLWPNSF-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 32.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.98 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|