C8H12ClN — CID 72622968
2-chloro-1,3,3a,4,7,7a-hexahydroisoindole (PubChem CID 72622968) has the molecular formula C8H12ClN and a molecular weight of 157.64 g/mol. Its IUPAC name is 2-chloro-1,3,3a,4,7,7a-hexahydroisoindole.
| Compound Name | 2-chloro-1,3,3a,4,7,7a-hexahydroisoindole |
|---|---|
| PubChem CID | 72622968 |
| Molecular Formula | C8H12ClN |
| Molecular Weight | 157.64 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | 2-chloro-1,3,3a,4,7,7a-hexahydroisoindole |
| SMILES | ClN1CC2CC=CCC2C1 |
| InChI | InChI=1S/C8H12ClN/c9-10-5-7-3-1-2-4-8(7)6-10/h1-2,7-8H,3-6H2 |
| InChIKey | JJZRNTGXWPGMDL-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.64 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|