C23H31N5O2 — CID 7262349
4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-N-(2,4-dimethylphenyl)-2-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxamide (PubChem CID 7262349) has the molecular formula C23H31N5O2 and a molecular weight of 409.53 g/mol. Its IUPAC name is 4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-N-(2,4-dimethylphenyl)-2-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxamide.
| Compound Name | 4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-N-(2,4-dimethylphenyl)-2-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 7262349 |
| Molecular Formula | C23H31N5O2 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.25 |
| IUPAC Name | 4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-N-(2,4-dimethylphenyl)-2-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxamide |
| SMILES | Cc1ccc(NC(=O)N2CCc3nc(C)nc(N4C[C@@H](C)O[C@H](C)C4)c3C2)c(C)c1 |
| InChI | InChI=1S/C23H31N5O2/c1-14-6-7-20(15(2)10-14)26-23(29)27-9-8-21-19(13-27)22(25-18(5)24-21)28-11-16(3)30-17(4)12-28/h6-7,10,16-17H,8-9,11-13H2,1-5H3,(H,26,29)/t16-,17-/m1/s1 |
| InChIKey | DDOKCBGYMOAYGZ-IAGOWNOFSA-N |
| XLogP | 3.61 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |