C21H18N4O2S — CID 72628090
4-methoxy-3-(2-pyridin-2-ylethenyl)-N-(thiophen-2-ylmethyl)-2H-indazole-5-carboxamide (PubChem CID 72628090) has the molecular formula C21H18N4O2S and a molecular weight of 390.47 g/mol. Its IUPAC name is 4-methoxy-3-(2-pyridin-2-ylethenyl)-N-(thiophen-2-ylmethyl)-2H-indazole-5-carboxamide.
| Compound Name | 4-methoxy-3-(2-pyridin-2-ylethenyl)-N-(thiophen-2-ylmethyl)-2H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 72628090 |
| Molecular Formula | C21H18N4O2S |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 4-methoxy-3-(2-pyridin-2-ylethenyl)-N-(thiophen-2-ylmethyl)-2H-indazole-5-carboxamide |
| SMILES | COc1c(C(=O)NCc2cccs2)ccc2n[nH]c(C=Cc3ccccn3)c12 |
| InChI | InChI=1S/C21H18N4O2S/c1-27-20-16(21(26)23-13-15-6-4-12-28-15)8-10-18-19(20)17(24-25-18)9-7-14-5-2-3-11-22-14/h2-12H,13H2,1H3,(H,23,26)(H,24,25) |
| InChIKey | ORWLACCCLNKNDS-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |