C20H14F2N4O — CID 72628295
N-[6-fluoro-3-[2-(4-fluorophenyl)ethenyl]-1H-indazol-5-yl]-1H-pyrrole-2-carboxamide (PubChem CID 72628295) has the molecular formula C20H14F2N4O and a molecular weight of 364.36 g/mol. Its IUPAC name is N-[6-fluoro-3-[2-(4-fluorophenyl)ethenyl]-1H-indazol-5-yl]-1H-pyrrole-2-carboxamide.
| Compound Name | N-[6-fluoro-3-[2-(4-fluorophenyl)ethenyl]-1H-indazol-5-yl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 72628295 |
| Molecular Formula | C20H14F2N4O |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | N-[6-fluoro-3-[2-(4-fluorophenyl)ethenyl]-1H-indazol-5-yl]-1H-pyrrole-2-carboxamide |
| SMILES | O=C(Nc1cc2c(C=Cc3ccc(F)cc3)n[nH]c2cc1F)c1ccc[nH]1 |
| InChI | InChI=1S/C20H14F2N4O/c21-13-6-3-12(4-7-13)5-8-16-14-10-19(15(22)11-18(14)26-25-16)24-20(27)17-2-1-9-23-17/h1-11,23H,(H,24,27)(H,25,26) |
| InChIKey | QEDHCSGOELMISG-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 73.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |