C17H15N3O3S — CID 7262982
1-(3,4-dihydroxyphenyl)-2-[[4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]ethanone (PubChem CID 7262982) has the molecular formula C17H15N3O3S and a molecular weight of 341.39 g/mol. Its IUPAC name is 1-(3,4-dihydroxyphenyl)-2-[[4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]ethanone.
| Compound Name | 1-(3,4-dihydroxyphenyl)-2-[[4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]ethanone |
|---|---|
| PubChem CID | 7262982 |
| Molecular Formula | C17H15N3O3S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | 1-(3,4-dihydroxyphenyl)-2-[[4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]ethanone |
| SMILES | Cc1ccccc1-n1cnnc1SCC(=O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C17H15N3O3S/c1-11-4-2-3-5-13(11)20-10-18-19-17(20)24-9-16(23)12-6-7-14(21)15(22)8-12/h2-8,10,21-22H,9H2,1H3 |
| InChIKey | KSVJYYPZHFSRPR-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|