C14H11FN2O — CID 72631051
N-(14-fluoro-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)hydroxylamine (PubChem CID 72631051) has the molecular formula C14H11FN2O and a molecular weight of 242.25 g/mol. Its IUPAC name is N-(14-fluoro-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)hydroxylamine.
| Compound Name | N-(14-fluoro-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 72631051 |
| Molecular Formula | C14H11FN2O |
| Molecular Weight | 242.25 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | N-(14-fluoro-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)hydroxylamine |
| SMILES | ON=C1c2cc(F)ccc2CCc2ncccc21 |
| InChI | InChI=1S/C14H11FN2O/c15-10-5-3-9-4-6-13-11(2-1-7-16-13)14(17-18)12(9)8-10/h1-3,5,7-8,18H,4,6H2 |
| InChIKey | ASYFSKDLZYLMNQ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.25 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|