C28H26N2O4 — CID 72631634
methyl 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1H-indol-3-yl)butanoate (PubChem CID 72631634) has the molecular formula C28H26N2O4 and a molecular weight of 454.53 g/mol. Its IUPAC name is methyl 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1H-indol-3-yl)butanoate.
| Compound Name | methyl 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1H-indol-3-yl)butanoate |
|---|---|
| PubChem CID | 72631634 |
| Molecular Formula | C28H26N2O4 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | methyl 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1H-indol-3-yl)butanoate |
| SMILES | COC(=O)C(NC(=O)OCC1c2ccccc2-c2ccccc21)C(C)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C28H26N2O4/c1-17(23-15-29-25-14-8-7-13-22(23)25)26(27(31)33-2)30-28(32)34-16-24-20-11-5-3-9-18(20)19-10-4-6-12-21(19)24/h3-15,17,24,26,29H,16H2,1-2H3,(H,30,32) |
| InChIKey | RNCYTMBLYCRDQC-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |