C32H27F4N3S — CID 72631836
2-[8-(4-fluorophenyl)-11a-methyl-3-(trifluoromethyl)-3,4,4a,5,6,11-hexahydro-2H-naphtho[1,2-f]indazol-4-yl]-5-phenyl-1,3-thiazole (PubChem CID 72631836) has the molecular formula C32H27F4N3S and a molecular weight of 561.65 g/mol. Its IUPAC name is 2-[8-(4-fluorophenyl)-11a-methyl-3-(trifluoromethyl)-3,4,4a,5,6,11-hexahydro-2H-naphtho[1,2-f]indazol-4-yl]-5-phenyl-1,3-thiazole.
| Compound Name | 2-[8-(4-fluorophenyl)-11a-methyl-3-(trifluoromethyl)-3,4,4a,5,6,11-hexahydro-2H-naphtho[1,2-f]indazol-4-yl]-5-phenyl-1,3-thiazole |
|---|---|
| PubChem CID | 72631836 |
| Molecular Formula | C32H27F4N3S |
| Molecular Weight | 561.65 g/mol |
| Exact Mass | 561.19 |
| IUPAC Name | 2-[8-(4-fluorophenyl)-11a-methyl-3-(trifluoromethyl)-3,4,4a,5,6,11-hexahydro-2H-naphtho[1,2-f]indazol-4-yl]-5-phenyl-1,3-thiazole |
| SMILES | CC12Cc3cnn(-c4ccc(F)cc4)c3C=C1CCC1C2=CCC(C(F)(F)F)C1c1ncc(-c2ccccc2)s1 |
| InChI | InChI=1S/C32H27F4N3S/c1-31-16-20-17-38-39(23-10-8-22(33)9-11-23)27(20)15-21(31)7-12-24-25(31)13-14-26(32(34,35)36)29(24)30-37-18-28(40-30)19-5-3-2-4-6-19/h2-6,8-11,13,15,17-18,24,26,29H,7,12,14,16H2,1H3 |
| InChIKey | QIPGQBLZJJLRJT-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.65 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|