C20H18FN5OS — CID 7263476
2-[2-[4-[(1R)-1-(4-fluorophenyl)ethyl]-5-sulfanylidene-1H-1,2,4-triazol-3-yl]ethyl]phthalazin-1-one (PubChem CID 7263476) has the molecular formula C20H18FN5OS and a molecular weight of 395.46 g/mol. Its IUPAC name is 2-[2-[4-[(1R)-1-(4-fluorophenyl)ethyl]-5-sulfanylidene-1H-1,2,4-triazol-3-yl]ethyl]phthalazin-1-one.
| Compound Name | 2-[2-[4-[(1R)-1-(4-fluorophenyl)ethyl]-5-sulfanylidene-1H-1,2,4-triazol-3-yl]ethyl]phthalazin-1-one |
|---|---|
| PubChem CID | 7263476 |
| Molecular Formula | C20H18FN5OS |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 2-[2-[4-[(1R)-1-(4-fluorophenyl)ethyl]-5-sulfanylidene-1H-1,2,4-triazol-3-yl]ethyl]phthalazin-1-one |
| SMILES | C[C@H](c1ccc(F)cc1)n1c(CCn2ncc3ccccc3c2=O)n[nH]c1=S |
| InChI | InChI=1S/C20H18FN5OS/c1-13(14-6-8-16(21)9-7-14)26-18(23-24-20(26)28)10-11-25-19(27)17-5-3-2-4-15(17)12-22-25/h2-9,12-13H,10-11H2,1H3,(H,24,28)/t13-/m1/s1 |
| InChIKey | FNYSWUGDFNCACH-CYBMUJFWSA-N |
| XLogP | 3.64 |
| TPSA | 68.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|