C34H36N8O4 — CID 72635982
2-[[2-[4-(dimethylaminomethylideneamino)pyrazolo[3,4-d]pyrimidin-1-yl]acetyl]-[2-[[(4-methoxyphenyl)-diphenylmethyl]amino]ethyl]amino]acetic acid (PubChem CID 72635982) has the molecular formula C34H36N8O4 and a molecular weight of 620.71 g/mol. Its IUPAC name is 2-[[2-[4-(dimethylaminomethylideneamino)pyrazolo[3,4-d]pyrimidin-1-yl]acetyl]-[2-[[(4-methoxyphenyl)-diphenylmethyl]amino]ethyl]amino]acetic acid.
| Compound Name | 2-[[2-[4-(dimethylaminomethylideneamino)pyrazolo[3,4-d]pyrimidin-1-yl]acetyl]-[2-[[(4-methoxyphenyl)-diphenylmethyl]amino]ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 72635982 |
| Molecular Formula | C34H36N8O4 |
| Molecular Weight | 620.71 g/mol |
| Exact Mass | 620.29 |
| IUPAC Name | 2-[[2-[4-(dimethylaminomethylideneamino)pyrazolo[3,4-d]pyrimidin-1-yl]acetyl]-[2-[[(4-methoxyphenyl)-diphenylmethyl]amino]ethyl]amino]acetic acid |
| SMILES | COc1ccc(C(NCCN(CC(=O)O)C(=O)Cn2ncc3c(N=CN(C)C)ncnc32)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C34H36N8O4/c1-40(2)24-37-32-29-20-39-42(33(29)36-23-35-32)21-30(43)41(22-31(44)45)19-18-38-34(25-10-6-4-7-11-25,26-12-8-5-9-13-26)27-14-16-28(46-3)17-15-27/h4-17,20,23-24,38H,18-19,21-22H2,1-3H3,(H,44,45) |
| InChIKey | MYXNOYLOMVAJLD-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 138.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.71 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|