C13H18N2O2S2 — CID 726364
1-(benzenesulfonyl)-3-cyclohexylthiourea (PubChem CID 726364) has the molecular formula C13H18N2O2S2 and a molecular weight of 298.43 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-3-cyclohexylthiourea.
| Compound Name | 1-(benzenesulfonyl)-3-cyclohexylthiourea |
|---|---|
| PubChem CID | 726364 |
| Molecular Formula | C13H18N2O2S2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 1-(benzenesulfonyl)-3-cyclohexylthiourea |
| SMILES | O=S(=O)(NC(=S)NC1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C13H18N2O2S2/c16-19(17,12-9-5-2-6-10-12)15-13(18)14-11-7-3-1-4-8-11/h2,5-6,9-11H,1,3-4,7-8H2,(H2,14,15,18) |
| InChIKey | KXTQOXUYGWFXGV-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|