C38H36F5N2S+ — CID 72637136
1,3,3-trimethyl-2-[2-[2-(2,3,4,5,6-pentafluorophenyl)sulfanyl-3-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]cyclohex-2-en-1-ylidene]ethylidene]indole (PubChem CID 72637136) has the molecular formula C38H36F5N2S+ and a molecular weight of 647.78 g/mol. Its IUPAC name is 1,3,3-trimethyl-2-[2-[2-(2,3,4,5,6-pentafluorophenyl)sulfanyl-3-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]cyclohex-2-en-1-ylidene]ethylidene]indole.
| Compound Name | 1,3,3-trimethyl-2-[2-[2-(2,3,4,5,6-pentafluorophenyl)sulfanyl-3-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]cyclohex-2-en-1-ylidene]ethylidene]indole |
|---|---|
| PubChem CID | 72637136 |
| Molecular Formula | C38H36F5N2S+ |
| Molecular Weight | 647.78 g/mol |
| Exact Mass | 647.25 |
| IUPAC Name | 1,3,3-trimethyl-2-[2-[2-(2,3,4,5,6-pentafluorophenyl)sulfanyl-3-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]cyclohex-2-en-1-ylidene]ethylidene]indole |
| SMILES | CN1C(=CC=C2CCCC(C=CC3=[N+](C)c4ccccc4C3(C)C)=C2Sc2c(F)c(F)c(F)c(F)c2F)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C38H36F5N2S/c1-37(2)24-14-7-9-16-26(24)44(5)28(37)20-18-22-12-11-13-23(35(22)46-36-33(42)31(40)30(39)32(41)34(36)43)19-21-29-38(3,4)25-15-8-10-17-27(25)45(29)6/h7-10,14-21H,11-13H2,1-6H3/q+1 |
| InChIKey | DQIDTNVYSJGTDM-UHFFFAOYSA-N |
| XLogP | 10.41 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.78 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|