C28H25N3O — CID 72637918
2-isocyano-2-[6'-[2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)ethenyl]spiro[1,3-dihydroindene-2,2'-3H-pyran]-4'-ylidene]acetonitrile (PubChem CID 72637918) has the molecular formula C28H25N3O and a molecular weight of 419.53 g/mol. Its IUPAC name is 2-isocyano-2-[6'-[2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)ethenyl]spiro[1,3-dihydroindene-2,2'-3H-pyran]-4'-ylidene]acetonitrile.
| Compound Name | 2-isocyano-2-[6'-[2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)ethenyl]spiro[1,3-dihydroindene-2,2'-3H-pyran]-4'-ylidene]acetonitrile |
|---|---|
| PubChem CID | 72637918 |
| Molecular Formula | C28H25N3O |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | 2-isocyano-2-[6'-[2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)ethenyl]spiro[1,3-dihydroindene-2,2'-3H-pyran]-4'-ylidene]acetonitrile |
| SMILES | [C-]#[N+]C(C#N)=C1C=C(C=Cc2ccc3c(c2)CCCN3C)OC2(C1)Cc1ccccc1C2 |
| InChI | InChI=1S/C28H25N3O/c1-30-26(19-29)24-15-25(32-28(18-24)16-22-6-3-4-7-23(22)17-28)11-9-20-10-12-27-21(14-20)8-5-13-31(27)2/h3-4,6-7,9-12,14-15H,5,8,13,16-18H2,2H3 |
| InChIKey | NFRQUUITNGBZNZ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|