C28H30N4O2S2 — CID 72639863
2-[5-acetyl-2-(ethylamino)phenyl]imino-3-benzyl-5-(3-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one (PubChem CID 72639863) has the molecular formula C28H30N4O2S2 and a molecular weight of 518.71 g/mol. Its IUPAC name is 2-[5-acetyl-2-(ethylamino)phenyl]imino-3-benzyl-5-(3-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one.
| Compound Name | 2-[5-acetyl-2-(ethylamino)phenyl]imino-3-benzyl-5-(3-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 72639863 |
| Molecular Formula | C28H30N4O2S2 |
| Molecular Weight | 518.71 g/mol |
| Exact Mass | 518.18 |
| IUPAC Name | 2-[5-acetyl-2-(ethylamino)phenyl]imino-3-benzyl-5-(3-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one |
| SMILES | CCNc1ccc(C(C)=O)cc1/N=C1\SC(=C2SC3=C(CCCC3)N2C)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C28H30N4O2S2/c1-4-29-21-15-14-20(18(2)33)16-22(21)30-28-32(17-19-10-6-5-7-11-19)26(34)25(36-28)27-31(3)23-12-8-9-13-24(23)35-27/h5-7,10-11,14-16,29H,4,8-9,12-13,17H2,1-3H3/b27-25?,30-28- |
| InChIKey | ZLEFMXIPJXHFFO-ATYUZXEASA-N |
| XLogP | 6.72 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.71 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|