About CID 72640013
CID 72640013 (PubChem CID 72640013) has the molecular formula C3H6BF
and a molecular weight of 71.89 g/mol.
Molecular Properties
| Compound Name | CID 72640013 |
| PubChem CID | 72640013 |
| Molecular Formula | C3H6BF |
| Molecular Weight | 71.89 g/mol |
| Exact Mass | 72.05 |
| IUPAC Name | — |
| SMILES | [B]CC(C)F |
| InChI | InChI=1S/C3H6BF/c1-3(5)2-4/h3H,2H2,1H3 |
| InChIKey | BKVKFOAEEUQYBT-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 71.89 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 72640013 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 72640013?
The IUPAC name of CID 72640013 (CID 72640013) is not available.
What is the SMILES notation for CID 72640013?
The canonical SMILES for CID 72640013 is [B]CC(C)F.
What is the InChIKey of CID 72640013?
The InChIKey is BKVKFOAEEUQYBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6BF/c1-3(5)2-4/h3H,2H2,1H3.
What are the key properties of CID 72640013?
CID 72640013 has a molecular weight of 71.89 g/mol, XLogP of 0.93, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 72640013 is sourced from PubChem (CID 72640013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).