About ethyl 3-[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]prop-2-enoate
ethyl 3-[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]prop-2-enoate (PubChem CID 72643756) has the molecular formula C12H16F3NO3
and a molecular weight of 279.26 g/mol. Its IUPAC name is ethyl 3-[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]prop-2-enoate.
Molecular Properties
| Compound Name | ethyl 3-[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]prop-2-enoate |
| PubChem CID | 72643756 |
| Molecular Formula | C12H16F3NO3 |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | ethyl 3-[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]prop-2-enoate |
| SMILES | CCOC(=O)C=CC1CCN(C(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H16F3NO3/c1-2-19-10(17)4-3-9-5-7-16(8-6-9)11(18)12(13,14)15/h3-4,9H,2,5-8H2,1H3 |
| InChIKey | XCKLSKDPKDDIBE-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]prop-2-enoate?
The IUPAC name of ethyl 3-[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]prop-2-enoate (CID 72643756) is ethyl 3-[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]prop-2-enoate.
What is the SMILES notation for ethyl 3-[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]prop-2-enoate?
The canonical SMILES for ethyl 3-[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]prop-2-enoate is CCOC(=O)C=CC1CCN(C(=O)C(F)(F)F)CC1.
What is the InChIKey of ethyl 3-[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]prop-2-enoate?
The InChIKey is XCKLSKDPKDDIBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16F3NO3/c1-2-19-10(17)4-3-9-5-7-16(8-6-9)11(18)12(13,14)15/h3-4,9H,2,5-8H2,1H3.
What are the key properties of ethyl 3-[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]prop-2-enoate?
ethyl 3-[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]prop-2-enoate has a molecular weight of 279.26 g/mol, XLogP of 1.91, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]prop-2-enoate is sourced from PubChem (CID 72643756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).