About 6-chloro-4-(2-cyclopropylethynyl)-1-methyl-4-(trifluoromethyl)-3,1-benzoxazin-2-one
6-chloro-4-(2-cyclopropylethynyl)-1-methyl-4-(trifluoromethyl)-3,1-benzoxazin-2-one (PubChem CID 72646780) has the molecular formula C15H11ClF3NO2
and a molecular weight of 329.71 g/mol. Its IUPAC name is 6-chloro-4-(2-cyclopropylethynyl)-1-methyl-4-(trifluoromethyl)-3,1-benzoxazin-2-one.
Molecular Properties
| Compound Name | 6-chloro-4-(2-cyclopropylethynyl)-1-methyl-4-(trifluoromethyl)-3,1-benzoxazin-2-one |
| PubChem CID | 72646780 |
| Molecular Formula | C15H11ClF3NO2 |
| Molecular Weight | 329.71 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | 6-chloro-4-(2-cyclopropylethynyl)-1-methyl-4-(trifluoromethyl)-3,1-benzoxazin-2-one |
| SMILES | CN1C(=O)OC(C#CC2CC2)(C(F)(F)F)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C15H11ClF3NO2/c1-20-12-5-4-10(16)8-11(12)14(15(17,18)19,22-13(20)21)7-6-9-2-3-9/h4-5,8-9H,2-3H2,1H3 |
| InChIKey | OPJRURLHBIVHSH-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.71 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-4-(2-cyclopropylethynyl)-1-methyl-4-(trifluoromethyl)-3,1-benzoxazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-4-(2-cyclopropylethynyl)-1-methyl-4-(trifluoromethyl)-3,1-benzoxazin-2-one?
The IUPAC name of 6-chloro-4-(2-cyclopropylethynyl)-1-methyl-4-(trifluoromethyl)-3,1-benzoxazin-2-one (CID 72646780) is 6-chloro-4-(2-cyclopropylethynyl)-1-methyl-4-(trifluoromethyl)-3,1-benzoxazin-2-one.
What is the SMILES notation for 6-chloro-4-(2-cyclopropylethynyl)-1-methyl-4-(trifluoromethyl)-3,1-benzoxazin-2-one?
The canonical SMILES for 6-chloro-4-(2-cyclopropylethynyl)-1-methyl-4-(trifluoromethyl)-3,1-benzoxazin-2-one is CN1C(=O)OC(C#CC2CC2)(C(F)(F)F)c2cc(Cl)ccc21.
What is the InChIKey of 6-chloro-4-(2-cyclopropylethynyl)-1-methyl-4-(trifluoromethyl)-3,1-benzoxazin-2-one?
The InChIKey is OPJRURLHBIVHSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11ClF3NO2/c1-20-12-5-4-10(16)8-11(12)14(15(17,18)19,22-13(20)21)7-6-9-2-3-9/h4-5,8-9H,2-3H2,1H3.
What are the key properties of 6-chloro-4-(2-cyclopropylethynyl)-1-methyl-4-(trifluoromethyl)-3,1-benzoxazin-2-one?
6-chloro-4-(2-cyclopropylethynyl)-1-methyl-4-(trifluoromethyl)-3,1-benzoxazin-2-one has a molecular weight of 329.71 g/mol, XLogP of 4.10, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-4-(2-cyclopropylethynyl)-1-methyl-4-(trifluoromethyl)-3,1-benzoxazin-2-one is sourced from PubChem (CID 72646780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).