About ethyl 4-[(2-amino-3,3-dimethylbutanoyl)-methylamino]-2,6-dimethylhept-2-enoate
ethyl 4-[(2-amino-3,3-dimethylbutanoyl)-methylamino]-2,6-dimethylhept-2-enoate (PubChem CID 72647104) has the molecular formula C18H34N2O3
and a molecular weight of 326.48 g/mol. Its IUPAC name is ethyl 4-[(2-amino-3,3-dimethylbutanoyl)-methylamino]-2,6-dimethylhept-2-enoate.
Molecular Properties
| Compound Name | ethyl 4-[(2-amino-3,3-dimethylbutanoyl)-methylamino]-2,6-dimethylhept-2-enoate |
| PubChem CID | 72647104 |
| Molecular Formula | C18H34N2O3 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.26 |
| IUPAC Name | ethyl 4-[(2-amino-3,3-dimethylbutanoyl)-methylamino]-2,6-dimethylhept-2-enoate |
| SMILES | CCOC(=O)C(C)=CC(CC(C)C)N(C)C(=O)C(N)C(C)(C)C |
| InChI | InChI=1S/C18H34N2O3/c1-9-23-17(22)13(4)11-14(10-12(2)3)20(8)16(21)15(19)18(5,6)7/h11-12,14-15H,9-10,19H2,1-8H3 |
| InChIKey | IKZPNPNMDQBLSR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-[(2-amino-3,3-dimethylbutanoyl)-methylamino]-2,6-dimethylhept-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[(2-amino-3,3-dimethylbutanoyl)-methylamino]-2,6-dimethylhept-2-enoate?
The IUPAC name of ethyl 4-[(2-amino-3,3-dimethylbutanoyl)-methylamino]-2,6-dimethylhept-2-enoate (CID 72647104) is ethyl 4-[(2-amino-3,3-dimethylbutanoyl)-methylamino]-2,6-dimethylhept-2-enoate.
What is the SMILES notation for ethyl 4-[(2-amino-3,3-dimethylbutanoyl)-methylamino]-2,6-dimethylhept-2-enoate?
The canonical SMILES for ethyl 4-[(2-amino-3,3-dimethylbutanoyl)-methylamino]-2,6-dimethylhept-2-enoate is CCOC(=O)C(C)=CC(CC(C)C)N(C)C(=O)C(N)C(C)(C)C.
What is the InChIKey of ethyl 4-[(2-amino-3,3-dimethylbutanoyl)-methylamino]-2,6-dimethylhept-2-enoate?
The InChIKey is IKZPNPNMDQBLSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34N2O3/c1-9-23-17(22)13(4)11-14(10-12(2)3)20(8)16(21)15(19)18(5,6)7/h11-12,14-15H,9-10,19H2,1-8H3.
What are the key properties of ethyl 4-[(2-amino-3,3-dimethylbutanoyl)-methylamino]-2,6-dimethylhept-2-enoate?
ethyl 4-[(2-amino-3,3-dimethylbutanoyl)-methylamino]-2,6-dimethylhept-2-enoate has a molecular weight of 326.48 g/mol, XLogP of 2.74, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[(2-amino-3,3-dimethylbutanoyl)-methylamino]-2,6-dimethylhept-2-enoate is sourced from PubChem (CID 72647104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).