C13H24N2O4 — CID 72647112
tert-butyl N-[1-[methoxy(methyl)amino]-1-oxopent-4-en-2-yl]-N-methylcarbamate (PubChem CID 72647112) has the molecular formula C13H24N2O4 and a molecular weight of 272.34 g/mol. Its IUPAC name is tert-butyl N-[1-[methoxy(methyl)amino]-1-oxopent-4-en-2-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[1-[methoxy(methyl)amino]-1-oxopent-4-en-2-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 72647112 |
| Molecular Formula | C13H24N2O4 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | tert-butyl N-[1-[methoxy(methyl)amino]-1-oxopent-4-en-2-yl]-N-methylcarbamate |
| SMILES | C=CCC(C(=O)N(C)OC)N(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H24N2O4/c1-8-9-10(11(16)15(6)18-7)14(5)12(17)19-13(2,3)4/h8,10H,1,9H2,2-7H3 |
| InChIKey | WXFWXSRFAAKDRA-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|