C21H29FO3 — CID 72647296
2-fluoro-3-[3-(methoxymethoxy)-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]pent-2-enal (PubChem CID 72647296) has the molecular formula C21H29FO3 and a molecular weight of 348.46 g/mol. Its IUPAC name is 2-fluoro-3-[3-(methoxymethoxy)-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]pent-2-enal.
| Compound Name | 2-fluoro-3-[3-(methoxymethoxy)-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]pent-2-enal |
|---|---|
| PubChem CID | 72647296 |
| Molecular Formula | C21H29FO3 |
| Molecular Weight | 348.46 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | 2-fluoro-3-[3-(methoxymethoxy)-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]pent-2-enal |
| SMILES | CCC(=C(F)C=O)c1cc2c(cc1OCOC)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C21H29FO3/c1-7-14(18(22)12-23)15-10-16-17(11-19(15)25-13-24-6)21(4,5)9-8-20(16,2)3/h10-12H,7-9,13H2,1-6H3 |
| InChIKey | UOTZKDDYWTZDAN-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.46 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|