C21H35N3O3S — CID 72649623
2-[(2-hydroxy-3-methylbutanoyl)amino]-N-[5-(6-methylhept-5-en-2-yl)-1,3-thiazol-2-yl]pentanamide (PubChem CID 72649623) has the molecular formula C21H35N3O3S and a molecular weight of 409.60 g/mol. Its IUPAC name is 2-[(2-hydroxy-3-methylbutanoyl)amino]-N-[5-(6-methylhept-5-en-2-yl)-1,3-thiazol-2-yl]pentanamide.
| Compound Name | 2-[(2-hydroxy-3-methylbutanoyl)amino]-N-[5-(6-methylhept-5-en-2-yl)-1,3-thiazol-2-yl]pentanamide |
|---|---|
| PubChem CID | 72649623 |
| Molecular Formula | C21H35N3O3S |
| Molecular Weight | 409.60 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | 2-[(2-hydroxy-3-methylbutanoyl)amino]-N-[5-(6-methylhept-5-en-2-yl)-1,3-thiazol-2-yl]pentanamide |
| SMILES | CCCC(NC(=O)C(O)C(C)C)C(=O)Nc1ncc(C(C)CCC=C(C)C)s1 |
| InChI | InChI=1S/C21H35N3O3S/c1-7-9-16(23-20(27)18(25)14(4)5)19(26)24-21-22-12-17(28-21)15(6)11-8-10-13(2)3/h10,12,14-16,18,25H,7-9,11H2,1-6H3,(H,23,27)(H,22,24,26) |
| InChIKey | JWACBBCMXAFRIX-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.60 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|