C40H46BrO2PS — CID 72652811
bromo-[3-methyl-5-(4-methylphenyl)sulfonyl-5-(2,6,6-trimethylcyclohexen-1-yl)pent-2-enyl]-triphenyl-λ5-phosphane (PubChem CID 72652811) has the molecular formula C40H46BrO2PS and a molecular weight of 701.75 g/mol. Its IUPAC name is bromo-[3-methyl-5-(4-methylphenyl)sulfonyl-5-(2,6,6-trimethylcyclohexen-1-yl)pent-2-enyl]-triphenyl-λ5-phosphane.
| Compound Name | bromo-[3-methyl-5-(4-methylphenyl)sulfonyl-5-(2,6,6-trimethylcyclohexen-1-yl)pent-2-enyl]-triphenyl-λ5-phosphane |
|---|---|
| PubChem CID | 72652811 |
| Molecular Formula | C40H46BrO2PS |
| Molecular Weight | 701.75 g/mol |
| Exact Mass | 700.21 |
| IUPAC Name | bromo-[3-methyl-5-(4-methylphenyl)sulfonyl-5-(2,6,6-trimethylcyclohexen-1-yl)pent-2-enyl]-triphenyl-λ5-phosphane |
| SMILES | CC(=CCP(Br)(c1ccccc1)(c1ccccc1)c1ccccc1)CC(C1=C(C)CCCC1(C)C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C40H46BrO2PS/c1-31-23-25-37(26-24-31)45(42,43)38(39-33(3)16-15-28-40(39,4)5)30-32(2)27-29-44(41,34-17-9-6-10-18-34,35-19-11-7-12-20-35)36-21-13-8-14-22-36/h6-14,17-27,38H,15-16,28-30H2,1-5H3 |
| InChIKey | IZDKDFDQTPDJFW-UHFFFAOYSA-N |
| XLogP | 9.84 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.75 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|