C24H25NO4S2 — CID 72655469
4-[5-[[3-(4-tert-butylphenoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid (PubChem CID 72655469) has the molecular formula C24H25NO4S2 and a molecular weight of 455.60 g/mol. Its IUPAC name is 4-[5-[[3-(4-tert-butylphenoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid.
| Compound Name | 4-[5-[[3-(4-tert-butylphenoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid |
|---|---|
| PubChem CID | 72655469 |
| Molecular Formula | C24H25NO4S2 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | 4-[5-[[3-(4-tert-butylphenoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid |
| SMILES | CC(C)(C)c1ccc(Oc2cccc(C=C3SC(=S)N(CCCC(=O)O)C3=O)c2)cc1 |
| InChI | InChI=1S/C24H25NO4S2/c1-24(2,3)17-9-11-18(12-10-17)29-19-7-4-6-16(14-19)15-20-22(28)25(23(30)31-20)13-5-8-21(26)27/h4,6-7,9-12,14-15H,5,8,13H2,1-3H3,(H,26,27) |
| InChIKey | DHQUEKKRXVWTLW-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|