C19H22Cl2F2N4O6 — CID 72656840
[5-[(5,6-dichloropyridine-3-carbonyl)amino]-1-(3,3-difluoropyrrolidin-1-yl)-1-oxopentan-2-yl]carbamoyloxymethyl acetate (PubChem CID 72656840) has the molecular formula C19H22Cl2F2N4O6 and a molecular weight of 511.31 g/mol. Its IUPAC name is [5-[(5,6-dichloropyridine-3-carbonyl)amino]-1-(3,3-difluoropyrrolidin-1-yl)-1-oxopentan-2-yl]carbamoyloxymethyl acetate.
| Compound Name | [5-[(5,6-dichloropyridine-3-carbonyl)amino]-1-(3,3-difluoropyrrolidin-1-yl)-1-oxopentan-2-yl]carbamoyloxymethyl acetate |
|---|---|
| PubChem CID | 72656840 |
| Molecular Formula | C19H22Cl2F2N4O6 |
| Molecular Weight | 511.31 g/mol |
| Exact Mass | 510.09 |
| IUPAC Name | [5-[(5,6-dichloropyridine-3-carbonyl)amino]-1-(3,3-difluoropyrrolidin-1-yl)-1-oxopentan-2-yl]carbamoyloxymethyl acetate |
| SMILES | CC(=O)OCOC(=O)NC(CCCNC(=O)c1cnc(Cl)c(Cl)c1)C(=O)N1CCC(F)(F)C1 |
| InChI | InChI=1S/C19H22Cl2F2N4O6/c1-11(28)32-10-33-18(31)26-14(17(30)27-6-4-19(22,23)9-27)3-2-5-24-16(29)12-7-13(20)15(21)25-8-12/h7-8,14H,2-6,9-10H2,1H3,(H,24,29)(H,26,31) |
| InChIKey | IRDOXMIIQGBQGJ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 126.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.31 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|