About 5-propyl-1H-1,2,4-triazol-3-amine
5-propyl-1H-1,2,4-triazol-3-amine (PubChem CID 726572) has the molecular formula C5H10N4
and a molecular weight of 126.16 g/mol. Its IUPAC name is 5-propyl-1H-1,2,4-triazol-3-amine.
Molecular Properties
| Compound Name | 5-propyl-1H-1,2,4-triazol-3-amine |
| PubChem CID | 726572 |
| Molecular Formula | C5H10N4 |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.09 |
| IUPAC Name | 5-propyl-1H-1,2,4-triazol-3-amine |
| SMILES | CCCc1nc(N)n[nH]1 |
| InChI | InChI=1S/C5H10N4/c1-2-3-4-7-5(6)9-8-4/h2-3H2,1H3,(H3,6,7,8,9) |
| InChIKey | GCPOFDRZTYMDKK-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-propyl-1H-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-propyl-1H-1,2,4-triazol-3-amine?
The IUPAC name of 5-propyl-1H-1,2,4-triazol-3-amine (CID 726572) is 5-propyl-1H-1,2,4-triazol-3-amine.
What is the SMILES notation for 5-propyl-1H-1,2,4-triazol-3-amine?
The canonical SMILES for 5-propyl-1H-1,2,4-triazol-3-amine is CCCc1nc(N)n[nH]1.
What is the InChIKey of 5-propyl-1H-1,2,4-triazol-3-amine?
The InChIKey is GCPOFDRZTYMDKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N4/c1-2-3-4-7-5(6)9-8-4/h2-3H2,1H3,(H3,6,7,8,9).
What are the key properties of 5-propyl-1H-1,2,4-triazol-3-amine?
5-propyl-1H-1,2,4-triazol-3-amine has a molecular weight of 126.16 g/mol, XLogP of 0.34, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-propyl-1H-1,2,4-triazol-3-amine is sourced from PubChem (CID 726572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).