C31H39N3O — CID 72658589
2-[2-tert-butyl-6-[3-[(2,2,8,8-tetramethyl-3,4,6,7-tetrahydroquinolizin-1-ylidene)methyl]penta-1,3-dienyl]pyran-4-ylidene]-2-isocyanoacetonitrile (PubChem CID 72658589) has the molecular formula C31H39N3O and a molecular weight of 469.67 g/mol. Its IUPAC name is 2-[2-tert-butyl-6-[3-[(2,2,8,8-tetramethyl-3,4,6,7-tetrahydroquinolizin-1-ylidene)methyl]penta-1,3-dienyl]pyran-4-ylidene]-2-isocyanoacetonitrile.
| Compound Name | 2-[2-tert-butyl-6-[3-[(2,2,8,8-tetramethyl-3,4,6,7-tetrahydroquinolizin-1-ylidene)methyl]penta-1,3-dienyl]pyran-4-ylidene]-2-isocyanoacetonitrile |
|---|---|
| PubChem CID | 72658589 |
| Molecular Formula | C31H39N3O |
| Molecular Weight | 469.67 g/mol |
| Exact Mass | 469.31 |
| IUPAC Name | 2-[2-tert-butyl-6-[3-[(2,2,8,8-tetramethyl-3,4,6,7-tetrahydroquinolizin-1-ylidene)methyl]penta-1,3-dienyl]pyran-4-ylidene]-2-isocyanoacetonitrile |
| SMILES | [C-]#[N+]C(C#N)=C1C=C(C=CC(=CC)C=C2C3=CC(C)(C)CCN3CCC2(C)C)OC(C(C)(C)C)=C1 |
| InChI | InChI=1S/C31H39N3O/c1-10-22(17-25-27-20-30(5,6)13-15-34(27)16-14-31(25,7)8)11-12-24-18-23(26(21-32)33-9)19-28(35-24)29(2,3)4/h10-12,17-20H,13-16H2,1-8H3 |
| InChIKey | JGUOZILUCCAWPA-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.67 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|