C17H22F3NO2 — CID 72658670
3-[2,6-di(propan-2-yl)-3-(2,2,2-trifluoroethoxy)-4-pyridinyl]but-2-enal (PubChem CID 72658670) has the molecular formula C17H22F3NO2 and a molecular weight of 329.36 g/mol. Its IUPAC name is 3-[2,6-di(propan-2-yl)-3-(2,2,2-trifluoroethoxy)-4-pyridinyl]but-2-enal.
| Compound Name | 3-[2,6-di(propan-2-yl)-3-(2,2,2-trifluoroethoxy)-4-pyridinyl]but-2-enal |
|---|---|
| PubChem CID | 72658670 |
| Molecular Formula | C17H22F3NO2 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 3-[2,6-di(propan-2-yl)-3-(2,2,2-trifluoroethoxy)-4-pyridinyl]but-2-enal |
| SMILES | CC(=CC=O)c1cc(C(C)C)nc(C(C)C)c1OCC(F)(F)F |
| InChI | InChI=1S/C17H22F3NO2/c1-10(2)14-8-13(12(5)6-7-22)16(15(21-14)11(3)4)23-9-17(18,19)20/h6-8,10-11H,9H2,1-5H3 |
| InChIKey | RUWLKYDCAAPANM-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|