C24H37NO6 — CID 72659024
3-nitro-3-nonadeca-4,7,10,13-tetraenylpentanedioic acid (PubChem CID 72659024) has the molecular formula C24H37NO6 and a molecular weight of 435.56 g/mol. Its IUPAC name is 3-nitro-3-nonadeca-4,7,10,13-tetraenylpentanedioic acid.
| Compound Name | 3-nitro-3-nonadeca-4,7,10,13-tetraenylpentanedioic acid |
|---|---|
| PubChem CID | 72659024 |
| Molecular Formula | C24H37NO6 |
| Molecular Weight | 435.56 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | 3-nitro-3-nonadeca-4,7,10,13-tetraenylpentanedioic acid |
| SMILES | CCCCCC=CCC=CCC=CCC=CCCCC(CC(=O)O)(CC(=O)O)[N+](=O)[O-] |
| InChI | InChI=1S/C24H37NO6/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-24(25(30)31,20-22(26)27)21-23(28)29/h6-7,9-10,12-13,15-16H,2-5,8,11,14,17-21H2,1H3,(H,26,27)(H,28,29) |
| InChIKey | RMXAVJTWOTUHDX-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 117.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.56 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|