C38H54O7 — CID 72659140
13,15,29-trihydroxy-2,12,14-trimethyl-30-(2-methyl-1,3-dioxolan-2-yl)hentriaconta-2,4,6,10,16,18,20,22,24,26-decaenoic acid (PubChem CID 72659140) has the molecular formula C38H54O7 and a molecular weight of 622.84 g/mol. Its IUPAC name is 13,15,29-trihydroxy-2,12,14-trimethyl-30-(2-methyl-1,3-dioxolan-2-yl)hentriaconta-2,4,6,10,16,18,20,22,24,26-decaenoic acid.
| Compound Name | 13,15,29-trihydroxy-2,12,14-trimethyl-30-(2-methyl-1,3-dioxolan-2-yl)hentriaconta-2,4,6,10,16,18,20,22,24,26-decaenoic acid |
|---|---|
| PubChem CID | 72659140 |
| Molecular Formula | C38H54O7 |
| Molecular Weight | 622.84 g/mol |
| Exact Mass | 622.39 |
| IUPAC Name | 13,15,29-trihydroxy-2,12,14-trimethyl-30-(2-methyl-1,3-dioxolan-2-yl)hentriaconta-2,4,6,10,16,18,20,22,24,26-decaenoic acid |
| SMILES | CC(=CC=CC=CCCC=CC(C)C(O)C(C)C(O)C=CC=CC=CC=CC=CC=CCC(O)C(C)C1(C)OCCO1)C(=O)O |
| InChI | InChI=1S/C38H54O7/c1-30(24-20-16-12-11-13-17-21-25-31(2)37(42)43)36(41)32(3)34(39)26-22-18-14-9-7-6-8-10-15-19-23-27-35(40)33(4)38(5)44-28-29-45-38/h6-11,13-15,17-26,30,32-36,39-41H,12,16,27-29H2,1-5H3,(H,42,43) |
| InChIKey | HKYBVAVCXNWLMG-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.84 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|