C19H33N — CID 72660168
N-butyl-3,7,11-trimethyldodeca-2,6,10-trien-1-imine (PubChem CID 72660168) has the molecular formula C19H33N and a molecular weight of 275.48 g/mol. Its IUPAC name is N-butyl-3,7,11-trimethyldodeca-2,6,10-trien-1-imine.
| Compound Name | N-butyl-3,7,11-trimethyldodeca-2,6,10-trien-1-imine |
|---|---|
| PubChem CID | 72660168 |
| Molecular Formula | C19H33N |
| Molecular Weight | 275.48 g/mol |
| Exact Mass | 275.26 |
| IUPAC Name | N-butyl-3,7,11-trimethyldodeca-2,6,10-trien-1-imine |
| SMILES | CCCC/N=C/C=C(C)CCC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C19H33N/c1-6-7-15-20-16-14-19(5)13-9-12-18(4)11-8-10-17(2)3/h10,12,14,16H,6-9,11,13,15H2,1-5H3/b18-12?,19-14?,20-16+ |
| InChIKey | BEGDNBZGPWZWGJ-STYNEIBHSA-N |
| XLogP | 6.28 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.48 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|