C12H19NO — CID 72660200
2-(3,7-dimethylocta-2,4,6-trienylideneamino)ethanol (PubChem CID 72660200) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is 2-(3,7-dimethylocta-2,4,6-trienylideneamino)ethanol.
| Compound Name | 2-(3,7-dimethylocta-2,4,6-trienylideneamino)ethanol |
|---|---|
| PubChem CID | 72660200 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 2-(3,7-dimethylocta-2,4,6-trienylideneamino)ethanol |
| SMILES | CC(C)=CC=CC(C)=C/C=N/CCO |
| InChI | InChI=1S/C12H19NO/c1-11(2)5-4-6-12(3)7-8-13-9-10-14/h4-8,14H,9-10H2,1-3H3/b6-4?,12-7?,13-8+ |
| InChIKey | FJZMVCBGWUHTHT-SYPIBMJGSA-N |
| XLogP | 2.52 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|