C14H19N3O — CID 72663440
6-(methylamino)-5,6,7,8,8a,9-hexahydro-4bH-carbazole-3-carboxamide (PubChem CID 72663440) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is 6-(methylamino)-5,6,7,8,8a,9-hexahydro-4bH-carbazole-3-carboxamide.
| Compound Name | 6-(methylamino)-5,6,7,8,8a,9-hexahydro-4bH-carbazole-3-carboxamide |
|---|---|
| PubChem CID | 72663440 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | 6-(methylamino)-5,6,7,8,8a,9-hexahydro-4bH-carbazole-3-carboxamide |
| SMILES | CNC1CCC2Nc3ccc(C(N)=O)cc3C2C1 |
| InChI | InChI=1S/C14H19N3O/c1-16-9-3-5-13-11(7-9)10-6-8(14(15)18)2-4-12(10)17-13/h2,4,6,9,11,13,16-17H,3,5,7H2,1H3,(H2,15,18) |
| InChIKey | SXXGWGNELXGULR-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |