C18H18N2O4 — CID 7266374
5,5-dimethyl-3-[(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl]imidazolidine-2,4-dione (PubChem CID 7266374) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is 5,5-dimethyl-3-[(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-dimethyl-3-[(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 7266374 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 5,5-dimethyl-3-[(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl]imidazolidine-2,4-dione |
| SMILES | CC1(C)NC(=O)N(Cc2cc(=O)oc3cc4c(cc23)CCC4)C1=O |
| InChI | InChI=1S/C18H18N2O4/c1-18(2)16(22)20(17(23)19-18)9-12-8-15(21)24-14-7-11-5-3-4-10(11)6-13(12)14/h6-8H,3-5,9H2,1-2H3,(H,19,23) |
| InChIKey | CYMXOQZCYUBTKC-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|