C32H36O8 — CID 72663859
(10'-hydroxy-1',6,9,10'-tetramethyl-6'-methylidene-2,5',7-trioxospiro[4,5,9a,9b-tetrahydro-3aH-azuleno[4,5-b]furan-3,14'-4-oxatetracyclo[10.2.1.02,11.03,7]pentadec-2(11)-ene]-4-yl) acetate (PubChem CID 72663859) has the molecular formula C32H36O8 and a molecular weight of 548.63 g/mol. Its IUPAC name is (10'-hydroxy-1',6,9,10'-tetramethyl-6'-methylidene-2,5',7-trioxospiro[4,5,9a,9b-tetrahydro-3aH-azuleno[4,5-b]furan-3,14'-4-oxatetracyclo[10.2.1.02,11.03,7]pentadec-2(11)-ene]-4-yl) acetate.
| Compound Name | (10'-hydroxy-1',6,9,10'-tetramethyl-6'-methylidene-2,5',7-trioxospiro[4,5,9a,9b-tetrahydro-3aH-azuleno[4,5-b]furan-3,14'-4-oxatetracyclo[10.2.1.02,11.03,7]pentadec-2(11)-ene]-4-yl) acetate |
|---|---|
| PubChem CID | 72663859 |
| Molecular Formula | C32H36O8 |
| Molecular Weight | 548.63 g/mol |
| Exact Mass | 548.24 |
| IUPAC Name | (10'-hydroxy-1',6,9,10'-tetramethyl-6'-methylidene-2,5',7-trioxospiro[4,5,9a,9b-tetrahydro-3aH-azuleno[4,5-b]furan-3,14'-4-oxatetracyclo[10.2.1.02,11.03,7]pentadec-2(11)-ene]-4-yl) acetate |
| SMILES | C=C1C(=O)OC2C3=C(C4CC3(C)C3(C4)C(=O)OC4C5C(C)=CC(=O)C5=C(C)CC(OC(C)=O)C43)C(C)(O)CCC12 |
| InChI | InChI=1S/C32H36O8/c1-13-9-19(34)21-14(2)10-20(38-16(4)33)24-27(22(13)21)40-29(36)32(24)12-17-11-30(32,5)25-23(17)31(6,37)8-7-18-15(3)28(35)39-26(18)25/h9,17-18,20,22,24,26-27,37H,3,7-8,10-12H2,1-2,4-6H3 |
| InChIKey | LXPAYRSNSZOZMG-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.63 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|