About 2-azido-3-bromobutane-1,4-diol
2-azido-3-bromobutane-1,4-diol (PubChem CID 72663930) has the molecular formula C4H8BrN3O2
and a molecular weight of 210.03 g/mol. Its IUPAC name is 2-azido-3-bromobutane-1,4-diol.
Molecular Properties
| Compound Name | 2-azido-3-bromobutane-1,4-diol |
| PubChem CID | 72663930 |
| Molecular Formula | C4H8BrN3O2 |
| Molecular Weight | 210.03 g/mol |
| Exact Mass | 208.98 |
| IUPAC Name | 2-azido-3-bromobutane-1,4-diol |
| SMILES | [N-]=[N+]=NC(CO)C(Br)CO |
| InChI | InChI=1S/C4H8BrN3O2/c5-3(1-9)4(2-10)7-8-6/h3-4,9-10H,1-2H2 |
| InChIKey | MCCAXQPPSKURKM-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 89.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.03 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-azido-3-bromobutane-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azido-3-bromobutane-1,4-diol?
The IUPAC name of 2-azido-3-bromobutane-1,4-diol (CID 72663930) is 2-azido-3-bromobutane-1,4-diol.
What is the SMILES notation for 2-azido-3-bromobutane-1,4-diol?
The canonical SMILES for 2-azido-3-bromobutane-1,4-diol is [N-]=[N+]=NC(CO)C(Br)CO.
What is the InChIKey of 2-azido-3-bromobutane-1,4-diol?
The InChIKey is MCCAXQPPSKURKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8BrN3O2/c5-3(1-9)4(2-10)7-8-6/h3-4,9-10H,1-2H2.
What are the key properties of 2-azido-3-bromobutane-1,4-diol?
2-azido-3-bromobutane-1,4-diol has a molecular weight of 210.03 g/mol, XLogP of 0.41, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azido-3-bromobutane-1,4-diol is sourced from PubChem (CID 72663930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).