C37H58O11 — CID 72666243
[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 11-hydroxy-8-(2-methoxy-2-oxoethyl)-1,2,6,6,9-pentamethyl-15-prop-1-en-2-yl-7-oxapentacyclo[11.7.0.02,10.05,9.014,18]icosane-18-carboxylate (PubChem CID 72666243) has the molecular formula C37H58O11 and a molecular weight of 678.86 g/mol. Its IUPAC name is [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 11-hydroxy-8-(2-methoxy-2-oxoethyl)-1,2,6,6,9-pentamethyl-15-prop-1-en-2-yl-7-oxapentacyclo[11.7.0.02,10.05,9.014,18]icosane-18-carboxylate.
| Compound Name | [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 11-hydroxy-8-(2-methoxy-2-oxoethyl)-1,2,6,6,9-pentamethyl-15-prop-1-en-2-yl-7-oxapentacyclo[11.7.0.02,10.05,9.014,18]icosane-18-carboxylate |
|---|---|
| PubChem CID | 72666243 |
| Molecular Formula | C37H58O11 |
| Molecular Weight | 678.86 g/mol |
| Exact Mass | 678.40 |
| IUPAC Name | [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 11-hydroxy-8-(2-methoxy-2-oxoethyl)-1,2,6,6,9-pentamethyl-15-prop-1-en-2-yl-7-oxapentacyclo[11.7.0.02,10.05,9.014,18]icosane-18-carboxylate |
| SMILES | C=C(C)C1CCC2(C(=O)OC3OC(CO)C(O)C(O)C3O)CCC3(C)C(CC(O)C4C5(C)C(CC(=O)OC)OC(C)(C)C5CCC43C)C12 |
| InChI | InChI=1S/C37H58O11/c1-18(2)19-9-12-37(32(44)47-31-29(43)28(42)27(41)22(17-38)46-31)14-13-34(5)20(26(19)37)15-21(39)30-35(34,6)11-10-23-33(3,4)48-24(36(23,30)7)16-25(40)45-8/h19-24,26-31,38-39,41-43H,1,9-17H2,2-8H3 |
| InChIKey | IXRYSFZKSCQFAA-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 172.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.86 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|