C15H20O5 — CID 72666597
4,11-dihydroxy-3,6,10-trimethyl-3,3a,4,5,11,11a-hexahydrocyclodeca[b]furan-2,8-dione (PubChem CID 72666597) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is 4,11-dihydroxy-3,6,10-trimethyl-3,3a,4,5,11,11a-hexahydrocyclodeca[b]furan-2,8-dione.
| Compound Name | 4,11-dihydroxy-3,6,10-trimethyl-3,3a,4,5,11,11a-hexahydrocyclodeca[b]furan-2,8-dione |
|---|---|
| PubChem CID | 72666597 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 4,11-dihydroxy-3,6,10-trimethyl-3,3a,4,5,11,11a-hexahydrocyclodeca[b]furan-2,8-dione |
| SMILES | CC1=CC(=O)C=C(C)C(O)C2OC(=O)C(C)C2C(O)C1 |
| InChI | InChI=1S/C15H20O5/c1-7-4-10(16)6-8(2)13(18)14-12(11(17)5-7)9(3)15(19)20-14/h4,6,9,11-14,17-18H,5H2,1-3H3 |
| InChIKey | UHAYFOFAYDNLOR-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |