About 3-(4-fluorophenyl)-[1,2,4]triazolo[4,3-a]pyridine
3-(4-fluorophenyl)-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 726694) has the molecular formula C12H8FN3
and a molecular weight of 213.22 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-[1,2,4]triazolo[4,3-a]pyridine.
Molecular Properties
| Compound Name | 3-(4-fluorophenyl)-[1,2,4]triazolo[4,3-a]pyridine |
| PubChem CID | 726694 |
| Molecular Formula | C12H8FN3 |
| Molecular Weight | 213.22 g/mol |
| Exact Mass | 213.07 |
| IUPAC Name | 3-(4-fluorophenyl)-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | Fc1ccc(-c2nnc3ccccn23)cc1 |
| InChI | InChI=1S/C12H8FN3/c13-10-6-4-9(5-7-10)12-15-14-11-3-1-2-8-16(11)12/h1-8H |
| InChIKey | MYVCXARJBZTJOH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.22 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(4-fluorophenyl)-[1,2,4]triazolo[4,3-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-fluorophenyl)-[1,2,4]triazolo[4,3-a]pyridine?
The IUPAC name of 3-(4-fluorophenyl)-[1,2,4]triazolo[4,3-a]pyridine (CID 726694) is 3-(4-fluorophenyl)-[1,2,4]triazolo[4,3-a]pyridine.
What is the SMILES notation for 3-(4-fluorophenyl)-[1,2,4]triazolo[4,3-a]pyridine?
The canonical SMILES for 3-(4-fluorophenyl)-[1,2,4]triazolo[4,3-a]pyridine is Fc1ccc(-c2nnc3ccccn23)cc1.
What is the InChIKey of 3-(4-fluorophenyl)-[1,2,4]triazolo[4,3-a]pyridine?
The InChIKey is MYVCXARJBZTJOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8FN3/c13-10-6-4-9(5-7-10)12-15-14-11-3-1-2-8-16(11)12/h1-8H.
What are the key properties of 3-(4-fluorophenyl)-[1,2,4]triazolo[4,3-a]pyridine?
3-(4-fluorophenyl)-[1,2,4]triazolo[4,3-a]pyridine has a molecular weight of 213.22 g/mol, XLogP of 2.54, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-fluorophenyl)-[1,2,4]triazolo[4,3-a]pyridine is sourced from PubChem (CID 726694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).