About [4-(8-acetyl-2-oxo-3-oxa-6-thia-8-azabicyclo[3.2.1]octan-4-yl)-2,3,4-triacetyloxybutyl] acetate
[4-(8-acetyl-2-oxo-3-oxa-6-thia-8-azabicyclo[3.2.1]octan-4-yl)-2,3,4-triacetyloxybutyl] acetate (PubChem CID 72671443) has the molecular formula C19H25NO11S
and a molecular weight of 475.47 g/mol. Its IUPAC name is [4-(8-acetyl-2-oxo-3-oxa-6-thia-8-azabicyclo[3.2.1]octan-4-yl)-2,3,4-triacetyloxybutyl] acetate.
Molecular Properties
| Compound Name | [4-(8-acetyl-2-oxo-3-oxa-6-thia-8-azabicyclo[3.2.1]octan-4-yl)-2,3,4-triacetyloxybutyl] acetate |
| PubChem CID | 72671443 |
| Molecular Formula | C19H25NO11S |
| Molecular Weight | 475.47 g/mol |
| Exact Mass | 475.11 |
| IUPAC Name | [4-(8-acetyl-2-oxo-3-oxa-6-thia-8-azabicyclo[3.2.1]octan-4-yl)-2,3,4-triacetyloxybutyl] acetate |
| SMILES | CC(=O)OCC(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C1OC(=O)C2CSC1N2C(C)=O |
| InChI | InChI=1S/C19H25NO11S/c1-8(21)20-13-7-32-18(20)17(31-19(13)26)16(30-12(5)25)15(29-11(4)24)14(28-10(3)23)6-27-9(2)22/h13-18H,6-7H2,1-5H3 |
| InChIKey | CLTRPFHGRORABV-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 151.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 475.47 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze [4-(8-acetyl-2-oxo-3-oxa-6-thia-8-azabicyclo[3.2.1]octan-4-yl)-2,3,4-triacetyloxybutyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(8-acetyl-2-oxo-3-oxa-6-thia-8-azabicyclo[3.2.1]octan-4-yl)-2,3,4-triacetyloxybutyl] acetate?
The IUPAC name of [4-(8-acetyl-2-oxo-3-oxa-6-thia-8-azabicyclo[3.2.1]octan-4-yl)-2,3,4-triacetyloxybutyl] acetate (CID 72671443) is [4-(8-acetyl-2-oxo-3-oxa-6-thia-8-azabicyclo[3.2.1]octan-4-yl)-2,3,4-triacetyloxybutyl] acetate.
What is the SMILES notation for [4-(8-acetyl-2-oxo-3-oxa-6-thia-8-azabicyclo[3.2.1]octan-4-yl)-2,3,4-triacetyloxybutyl] acetate?
The canonical SMILES for [4-(8-acetyl-2-oxo-3-oxa-6-thia-8-azabicyclo[3.2.1]octan-4-yl)-2,3,4-triacetyloxybutyl] acetate is CC(=O)OCC(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C1OC(=O)C2CSC1N2C(C)=O.
What is the InChIKey of [4-(8-acetyl-2-oxo-3-oxa-6-thia-8-azabicyclo[3.2.1]octan-4-yl)-2,3,4-triacetyloxybutyl] acetate?
The InChIKey is CLTRPFHGRORABV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25NO11S/c1-8(21)20-13-7-32-18(20)17(31-19(13)26)16(30-12(5)25)15(29-11(4)24)14(28-10(3)23)6-27-9(2)22/h13-18H,6-7H2,1-5H3.
What are the key properties of [4-(8-acetyl-2-oxo-3-oxa-6-thia-8-azabicyclo[3.2.1]octan-4-yl)-2,3,4-triacetyloxybutyl] acetate?
[4-(8-acetyl-2-oxo-3-oxa-6-thia-8-azabicyclo[3.2.1]octan-4-yl)-2,3,4-triacetyloxybutyl] acetate has a molecular weight of 475.47 g/mol, XLogP of -0.44, 8 rotatable bonds, 0 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(8-acetyl-2-oxo-3-oxa-6-thia-8-azabicyclo[3.2.1]octan-4-yl)-2,3,4-triacetyloxybutyl] acetate is sourced from PubChem (CID 72671443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).