C19H40N4 — CID 72671829
N'-(3-aminopropyl)-N'-[3-(3,7-dimethylocta-2,6-dienylamino)propyl]propane-1,3-diamine (PubChem CID 72671829) has the molecular formula C19H40N4 and a molecular weight of 324.56 g/mol. Its IUPAC name is N'-(3-aminopropyl)-N'-[3-(3,7-dimethylocta-2,6-dienylamino)propyl]propane-1,3-diamine.
| Compound Name | N'-(3-aminopropyl)-N'-[3-(3,7-dimethylocta-2,6-dienylamino)propyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 72671829 |
| Molecular Formula | C19H40N4 |
| Molecular Weight | 324.56 g/mol |
| Exact Mass | 324.33 |
| IUPAC Name | N'-(3-aminopropyl)-N'-[3-(3,7-dimethylocta-2,6-dienylamino)propyl]propane-1,3-diamine |
| SMILES | CC(C)=CCCC(C)=CCNCCCN(CCCN)CCCN |
| InChI | InChI=1S/C19H40N4/c1-18(2)8-4-9-19(3)10-14-22-13-7-17-23(15-5-11-20)16-6-12-21/h8,10,22H,4-7,9,11-17,20-21H2,1-3H3 |
| InChIKey | KEPABEGBSVHEHB-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.56 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|