C17H35N3 — CID 72671830
N'-[3-(3,7-dimethylocta-2,6-dienylamino)propyl]-N'-methylpropane-1,3-diamine (PubChem CID 72671830) has the molecular formula C17H35N3 and a molecular weight of 281.49 g/mol. Its IUPAC name is N'-[3-(3,7-dimethylocta-2,6-dienylamino)propyl]-N'-methylpropane-1,3-diamine.
| Compound Name | N'-[3-(3,7-dimethylocta-2,6-dienylamino)propyl]-N'-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 72671830 |
| Molecular Formula | C17H35N3 |
| Molecular Weight | 281.49 g/mol |
| Exact Mass | 281.28 |
| IUPAC Name | N'-[3-(3,7-dimethylocta-2,6-dienylamino)propyl]-N'-methylpropane-1,3-diamine |
| SMILES | CC(C)=CCCC(C)=CCNCCCN(C)CCCN |
| InChI | InChI=1S/C17H35N3/c1-16(2)8-5-9-17(3)10-13-19-12-7-15-20(4)14-6-11-18/h8,10,19H,5-7,9,11-15,18H2,1-4H3 |
| InChIKey | VDLUUXZYJFKAFB-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.49 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|