C20H44N6 — CID 72671835
N'-[2-[2-[2-[2-(3,7-dimethylocta-2,6-dienylamino)ethylamino]ethylamino]ethylamino]ethyl]ethane-1,2-diamine (PubChem CID 72671835) has the molecular formula C20H44N6 and a molecular weight of 368.61 g/mol. Its IUPAC name is N'-[2-[2-[2-[2-(3,7-dimethylocta-2,6-dienylamino)ethylamino]ethylamino]ethylamino]ethyl]ethane-1,2-diamine.
| Compound Name | N'-[2-[2-[2-[2-(3,7-dimethylocta-2,6-dienylamino)ethylamino]ethylamino]ethylamino]ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 72671835 |
| Molecular Formula | C20H44N6 |
| Molecular Weight | 368.61 g/mol |
| Exact Mass | 368.36 |
| IUPAC Name | N'-[2-[2-[2-[2-(3,7-dimethylocta-2,6-dienylamino)ethylamino]ethylamino]ethylamino]ethyl]ethane-1,2-diamine |
| SMILES | CC(C)=CCCC(C)=CCNCCNCCNCCNCCNCCN |
| InChI | InChI=1S/C20H44N6/c1-19(2)5-4-6-20(3)7-9-22-11-13-24-15-17-26-18-16-25-14-12-23-10-8-21/h5,7,22-26H,4,6,8-18,21H2,1-3H3 |
| InChIKey | LWVGSSQNLIDBNT-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 86.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.61 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|