2-(2,4-dihydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid

C10H11NO4S — CID 72678596

IUPAC2-(2,4-dihydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid
SMILESO=C(O)C1CSC(c2ccc(O)cc2O)N1
InChIInChI=1S/C10H11NO4S/c12-5-1-2-6(8(13)3-5)9-11-7(4-16-9)10(14)15/h1-3,7,9,11-13H,4H2,(H,14,15)
InChIKeyGYBITJROHWLVSE-UHFFFAOYSA-N
MW241.27 g/mol
LogP0.89
Rot. Bonds2

About 2-(2,4-dihydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid

2-(2,4-dihydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 72678596) has the molecular formula C10H11NO4S and a molecular weight of 241.27 g/mol. Its IUPAC name is 2-(2,4-dihydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid.

Molecular Properties

Compound Name2-(2,4-dihydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid
PubChem CID72678596
Molecular FormulaC10H11NO4S
Molecular Weight241.27 g/mol
Exact Mass241.04
IUPAC Name2-(2,4-dihydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid
SMILESO=C(O)C1CSC(c2ccc(O)cc2O)N1
InChIInChI=1S/C10H11NO4S/c12-5-1-2-6(8(13)3-5)9-11-7(4-16-9)10(14)15/h1-3,7,9,11-13H,4H2,(H,14,15)
InChIKeyGYBITJROHWLVSE-UHFFFAOYSA-N
XLogP0.89
TPSA89.79 Ų
H-Bond Donors4
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500241.27
LogP ≤ 50.89
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}

Analyze 2-(2,4-dihydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,4-dihydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid?
The IUPAC name of 2-(2,4-dihydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid (CID 72678596) is 2-(2,4-dihydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid.
What is the SMILES notation for 2-(2,4-dihydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid?
The canonical SMILES for 2-(2,4-dihydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid is O=C(O)C1CSC(c2ccc(O)cc2O)N1.
What is the InChIKey of 2-(2,4-dihydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid?
The InChIKey is GYBITJROHWLVSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO4S/c12-5-1-2-6(8(13)3-5)9-11-7(4-16-9)10(14)15/h1-3,7,9,11-13H,4H2,(H,14,15).
What are the key properties of 2-(2,4-dihydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid?
2-(2,4-dihydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid has a molecular weight of 241.27 g/mol, XLogP of 0.89, 2 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dihydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid is sourced from PubChem (CID 72678596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).