C30H46O4 — CID 72678741
15-[4-(3,3-dimethyloxiran-2-yl)-4-oxobutan-2-yl]-6-hydroxy-7,7,12,16-tetramethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecan-14-one (PubChem CID 72678741) has the molecular formula C30H46O4 and a molecular weight of 470.69 g/mol. Its IUPAC name is 15-[4-(3,3-dimethyloxiran-2-yl)-4-oxobutan-2-yl]-6-hydroxy-7,7,12,16-tetramethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecan-14-one.
| Compound Name | 15-[4-(3,3-dimethyloxiran-2-yl)-4-oxobutan-2-yl]-6-hydroxy-7,7,12,16-tetramethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecan-14-one |
|---|---|
| PubChem CID | 72678741 |
| Molecular Formula | C30H46O4 |
| Molecular Weight | 470.69 g/mol |
| Exact Mass | 470.34 |
| IUPAC Name | 15-[4-(3,3-dimethyloxiran-2-yl)-4-oxobutan-2-yl]-6-hydroxy-7,7,12,16-tetramethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecan-14-one |
| SMILES | CC(CC(=O)C1OC1(C)C)C1C(=O)CC2(C)C3CCC4C(C)(C)C(O)CCC45CC35CCC12C |
| InChI | InChI=1S/C30H46O4/c1-17(14-18(31)24-26(4,5)34-24)23-19(32)15-28(7)21-9-8-20-25(2,3)22(33)10-11-29(20)16-30(21,29)13-12-27(23,28)6/h17,20-24,33H,8-16H2,1-7H3 |
| InChIKey | ZQTCNCRNSHEBBU-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 66.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.69 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|